(S)-3-BIPHENYL-4-YL-2-(9H-FLUOREN-9-YLMETHOXYCARBONYLAMINO)-PROPIONIC ACID - Names and Identifiers
Name | Fmoc-4-phenyl-Phe-OH
|
Synonyms | Fmoc-Bip(4,4')-OH Fmoc-L-Bip(4,4')-OH Fmoc-L-4,4'-Biphe-OH Fmoc-4-phenyl-Phe-OH Fmoc-L-4,4'-Biphenylalanine FMOC-L-4,4'-BIPHENYLALANINE Fmoc-L-4,4'-Biphenylphenylalanine Fmoc-(S)-3-(biphenyl4-yl)-alanine (9H-Fluoren-9-yl)MethOxy]Carbonyl Bip(4,4')-OH N-ALPHA-(9-FLUORENYLMETHOXYCARBONYL)-L-4,4'-BIPHENYLALANINE (S)-3-BIPHENYL-4-YL-2-(9H-FLUOREN-9-YLMETHOXYCARBONYLAMINO)-PROPIONIC ACID (S)-2-((((9H-Fluoren-9-yl)Methoxy)carbonyl)aMino)-3-([1,1'-biphenyl]-4-yl)propanoic acid
|
CAS | 199110-64-0
|
InChI | InChI=1/C33H30N2O6/c34-29(31(36)37)17-20-9-13-22(14-10-20)23-15-11-21(12-16-23)18-30(32(38)39)35-33(40)41-19-28-26-7-3-1-5-24(26)25-6-2-4-8-27(25)28/h1-16,28-30H,17-19,34H2,(H,35,40)(H,36,37)(H,38,39)/t29-,30-/m0/s1 |
(S)-3-BIPHENYL-4-YL-2-(9H-FLUOREN-9-YLMETHOXYCARBONYLAMINO)-PROPIONIC ACID - Physico-chemical Properties
Molecular Formula | C30H25NO4
|
Molar Mass | 463.52 |
Density | 1.257±0.06 g/cm3 (20 ºC 760 Torr) |
Boling Point | 700.7±60.0 °C(Predicted) |
Flash Point | 441°C |
Vapor Presure | 2.13E-27mmHg at 25°C |
pKa | 3.77±0.10(Predicted) |
Storage Condition | Sealed in dry,2-8°C |
Refractive Index | 1.651 |
(S)-3-BIPHENYL-4-YL-2-(9H-FLUOREN-9-YLMETHOXYCARBONYLAMINO)-PROPIONIC ACID - Risk and Safety
Hazard Symbols | Xi - Irritant
|
(S)-3-BIPHENYL-4-YL-2-(9H-FLUOREN-9-YLMETHOXYCARBONYLAMINO)-PROPIONIC ACID - Introduction
Fmoc-4-phenyl-Phe-OH(Fmoc-L-4,4 '-diphenylalanine) is an amino acid derivative with the following properties:
1. Appearance: The Fmoc-4-phenyl-Phe-OH is a white crystalline solid.
2. Solubility: It is soluble in organic solvents (such as dichloromethane, methanol, dimethyl sulfoxide, etc.), but the solubility in water is low.
3. Structure: It is composed of L-4,4 '-biphenylalanine combined with Fmoc group (9-fluoromethylene -1-methoxycarbonyl).
The main uses of Fmoc-4-phenyl-Phe-OH are as follows:
1. Chemical synthesis: As a protecting group in the synthesis of polypeptides and proteins, it is commonly used in amino acid coupling reactions in solid phase synthesis.
2. Biomedical Research: for the synthesis of biologically active peptides, such as drugs, antimicrobial peptides, peptide ligands, etc.
The preparation method of Fmoc-4-phenyl-Phe-OH is mainly organic synthesis chemical reaction. The commonly used method is to react L-4,4 '-biphenylalanine with Fmoc chloride to obtain the target product.
Regarding safety information, the Fmoc-4-phenyl-Phe-OH is generally safe under normal operating conditions. However, any chemical should be used with caution. In the use of the process need to comply with the safety procedures, wear appropriate personal protective equipment, such as gloves, goggles, etc. Please refer to the relevant Safety Data Sheet for the specific toxicity and danger of the compound.
Last Update:2024-04-09 20:45:29